EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H4N4 |
| Net Charge | 0 |
| Average Mass | 120.115 |
| Monoisotopic Mass | 120.04360 |
| SMILES | c1ncc2ncnc2n1 |
| InChI | InChI=1S/C5H4N4/c1-4-5(8-2-6-1)9-3-7-4/h1-3H,(H,6,7,8,9) |
| InChIKey | KDCGOANMDULRCW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7H-purine (CHEBI:17258) is a purine (CHEBI:35584) |
| 7H-purine (CHEBI:17258) is tautomer of 1H-purine (CHEBI:35586) |
| 7H-purine (CHEBI:17258) is tautomer of 3H-purine (CHEBI:35588) |
| 7H-purine (CHEBI:17258) is tautomer of 9H-purine (CHEBI:35589) |
| Incoming Relation(s) |
| purine-6-thiol (CHEBI:2208) has parent hydride 7H-purine (CHEBI:17258) |
| 1H-purine (CHEBI:35586) is tautomer of 7H-purine (CHEBI:17258) |
| 3H-purine (CHEBI:35588) is tautomer of 7H-purine (CHEBI:17258) |
| 9H-purine (CHEBI:35589) is tautomer of 7H-purine (CHEBI:17258) |
| IUPAC Name |
|---|
| 7H-purine |
| Synonyms | Source |
|---|---|
| Purine | KEGG COMPOUND |
| Purine base | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C15587 | KEGG COMPOUND |
| HMDB0001366 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3200 | Reaxys |
| Gmelin:601779 | Gmelin |