EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:17257 - bis-γ-glutamylcystine
| Formula | C16H26N4O10S2 |
| Net Charge | 0 |
| Average Mass | 498.536 |
| Monoisotopic Mass | 498.10904 |
| SMILES | NC(CCC(=O)NC(CSSCC(NC(=O)CCC(N)C(=O)O)C(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C16H26N4O10S2/c17-7(13(23)24)1-3-11(21)19-9(15(27)28)5-31-32-6-10(16(29)30)20-12(22)4-2-8(18)14(25)26/h7-10H,1-6,17-18H2,(H,19,21)(H,20,22)(H,23,24)(H,25,26)(H,27,28)(H,29,30) |
| InChIKey | GOZJYXJJQVGDOJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bis-γ-glutamylcystine (CHEBI:17257) is a gamma-glutamylcysteine (CHEBI:24195) |
| bis-γ-glutamylcystine (CHEBI:17257) is conjugate acid of bis-γ-glutamylcystinate(2−) (CHEBI:58077) |
| Incoming Relation(s) |
| bis-γ-glutamylcystinate(2−) (CHEBI:58077) is conjugate base of bis-γ-glutamylcystine (CHEBI:17257) |
| IUPAC Name |
|---|
| 5,5'-{disulfanediylbis[(1-carboxyethane-2,1-diyl)imino]}bis(2-amino-5-oxopentanoic acid) |
| Synonyms | Source |
|---|---|
| Bis-gamma-glutamylcystine | KEGG COMPOUND |
| Oxidized gamma-glutamylcysteine | KEGG COMPOUND |
| Oxidized gamma-L-glutamyl-L-cysteine | KEGG COMPOUND |
| Bis-gamma-L-glutamyl-L-cystine | KEGG COMPOUND |