EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H24O6 |
| Net Charge | 0 |
| Average Mass | 324.373 |
| Monoisotopic Mass | 324.15729 |
| SMILES | CCC(C)C(O)C(=O)OC(/C=C/C=C/C=C/C(=O)O)C1(C)CO1 |
| InChI | InChI=1S/C17H24O6/c1-4-12(2)15(20)16(21)23-13(17(3)11-22-17)9-7-5-6-8-10-14(18)19/h5-10,12-13,15,20H,4,11H2,1-3H3,(H,18,19)/b6-5+,9-7+,10-8+ |
| InChIKey | PXZGUAVTZUPRMI-NRIIQWGUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2633) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| AF Toxin II (CHEBI:172551) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (2E,4E,6E)-8-(2-hydroxy-3-methylpentanoyl)oxy-8-(2-methyloxiran-2-yl)octa-2,4,6-trienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4946907 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:108102-60-9 | ChemIDplus |