EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24O4 |
| Net Charge | 0 |
| Average Mass | 316.397 |
| Monoisotopic Mass | 316.16746 |
| SMILES | C=C(C)C1CCC(COC(=O)/C=C/c2ccc(O)c(O)c2)CC1 |
| InChI | InChI=1S/C19H24O4/c1-13(2)16-7-3-15(4-8-16)12-23-19(22)10-6-14-5-9-17(20)18(21)11-14/h5-6,9-11,15-16,20-21H,1,3-4,7-8,12H2,2H3/b10-6+ |
| InChIKey | SSVXLIRLGPMWSL-UXBLZVDNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2633) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Isopulegone caffeate (CHEBI:172548) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| (4-prop-1-en-2-ylcyclohexyl)methyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| Manual Xrefs | Databases |
|---|---|
| 13385963 | ChemSpider |
| HMDB0029566 | HMDB |