EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H23N3O6 |
| Net Charge | 0 |
| Average Mass | 305.331 |
| Monoisotopic Mass | 305.15869 |
| SMILES | NC(CCC(O)/C=N/CC(O)CCC(N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C12H23N3O6/c13-9(11(18)19)3-1-7(16)5-15-6-8(17)2-4-10(14)12(20)21/h5,7-10,16-17H,1-4,6,13-14H2,(H,18,19)(H,20,21)/b15-5+ |
| InChIKey | QWGIOMIEVFVREE-PJQLUOCWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2633) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Syndesine (CHEBI:172532) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 2-amino-6-[(5-amino-5-carboxy-2-hydroxypentylidene)amino]-5-hydroxyhexanoic acid |