EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H19N3O4 |
| Net Charge | 0 |
| Average Mass | 305.334 |
| Monoisotopic Mass | 305.13756 |
| SMILES | CC(O)C(N)C(=O)NC(Cc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C15H19N3O4/c1-8(19)13(16)14(20)18-12(15(21)22)6-9-7-17-11-5-3-2-4-10(9)11/h2-5,7-8,12-13,17,19H,6,16H2,1H3,(H,18,20)(H,21,22) |
| InChIKey | KAFKKRJQHOECGW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2633) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Threoninyl-Tryptophan (CHEBI:172531) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| 2-[(2-amino-3-hydroxybutanoyl)amino]-3-(1H-indol-3-yl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 16568396 | ChemSpider |
| HMDB0029072 | HMDB |