EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H16O3 |
| Net Charge | 0 |
| Average Mass | 292.334 |
| Monoisotopic Mass | 292.10994 |
| SMILES | O=C(/C=C\c1ccc(O)cc1)/C=C/C=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C19H16O3/c20-17(10-7-16-8-13-19(22)14-9-16)4-2-1-3-15-5-11-18(21)12-6-15/h1-14,21-22H/b3-1+,4-2+,10-7- |
| InChIKey | PALMCMYYFAHUGA-ZRFKDBLFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2633) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (all-E)-1,7-bis(4-hydroxyphenyl)-1,4,6-heptatrien-3-one (CHEBI:172523) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| (1Z,4E,6E)-1,7-bis(4-hydroxyphenyl)hepta-1,4,6-trien-3-one |
| Manual Xrefs | Databases |
|---|---|
| 30777515 | ChemSpider |
| HMDB0040889 | HMDB |