EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22O4 |
| Net Charge | 0 |
| Average Mass | 290.359 |
| Monoisotopic Mass | 290.15181 |
| SMILES | CCCCCC(=O)CC(=O)/C=C/c1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C17H22O4/c1-3-4-5-6-14(18)12-15(19)9-7-13-8-10-16(20)17(11-13)21-2/h7-11,20H,3-6,12H2,1-2H3/b9-7+ |
| InChIKey | JUKHKHMSQCQHEN-VQHVLOKHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2633) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [6]-Dehydrogingerdione (CHEBI:172522) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| (E)-1-(4-hydroxy-3-methoxyphenyl)dec-1-ene-3,5-dione |
| Manual Xrefs | Databases |
|---|---|
| 7971781 | ChemSpider |