EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14O8 |
| Net Charge | 0 |
| Average Mass | 286.236 |
| Monoisotopic Mass | 286.06887 |
| SMILES | COc1cc(CC(O)(C(=O)O)C(O)C(=O)O)ccc1O |
| InChI | InChI=1S/C12H14O8/c1-20-8-4-6(2-3-7(8)13)5-12(19,11(17)18)9(14)10(15)16/h2-4,9,13-14,19H,5H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | DDSGTDZCSPMYIM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2633) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3'-Methoxyfukiic acid (CHEBI:172518) is a benzenes (CHEBI:22712) |
| 3'-Methoxyfukiic acid (CHEBI:172518) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 2,3-dihydroxy-2-[(4-hydroxy-3-methoxyphenyl)methyl]butanedioic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029498 | HMDB |
| 35013063 | ChemSpider |