EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16O6 |
| Net Charge | 0 |
| Average Mass | 280.276 |
| Monoisotopic Mass | 280.09469 |
| SMILES | CC(C)(O)C1Cc2c(O)c(O)cc(/C=C/C(=O)O)c2O1 |
| InChI | InChI=1S/C14H16O6/c1-14(2,19)10-6-8-12(18)9(15)5-7(13(8)20-10)3-4-11(16)17/h3-5,10,15,18-19H,6H2,1-2H3,(H,16,17)/b4-3+ |
| InChIKey | DABSIZUNYJTFDJ-ONEGZZNKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2633) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gravolenic acid (CHEBI:172516) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| (E)-3-[4,5-dihydroxy-2-(2-hydroxypropan-2-yl)-2,3-dihydro-1-benzouran-7-yl]prop-2-enoic acid |