EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16N2O2 |
| Net Charge | 0 |
| Average Mass | 256.305 |
| Monoisotopic Mass | 256.12118 |
| SMILES | OCCCC(O)c1nccc2c1nc1ccccc12 |
| InChI | InChI=1S/C15H16N2O2/c18-9-3-6-13(19)15-14-11(7-8-16-15)10-4-1-2-5-12(10)17-14/h1-2,4-5,7-8,13,17-19H,3,6,9H2 |
| InChIKey | SPYBYBYFMPTBMD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2633) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(9H-Pyrido[3,4-b]indol-1-yl)-1,4-butanediol (CHEBI:172497) is a harmala alkaloid (CHEBI:61379) |
| IUPAC Name |
|---|
| 1-(9H-pyrido[3,4-b]indol-1-yl)butane-1,4-diol |
| Manual Xrefs | Databases |
|---|---|
| 35013869 | ChemSpider |
| HMDB0035193 | HMDB |