EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18N2O |
| Net Charge | 0 |
| Average Mass | 254.333 |
| Monoisotopic Mass | 254.14191 |
| SMILES | CN1CC(C)(O)C=C2c3cccc4ncc(c34)CC21 |
| InChI | InChI=1S/C16H18N2O/c1-16(19)7-12-11-4-3-5-13-15(11)10(8-17-13)6-14(12)18(2)9-16/h3-5,7-8,14,17,19H,6,9H2,1-2H3 |
| InChIKey | BGVUWLLRNRBDAY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2633) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-Setoclavine (CHEBI:172496) is a alkaloid (CHEBI:22315) |
| IUPAC Name |
|---|
| 7,9-dimethyl-4,6,6a,8-tetrahydroindolo[4,3-g]quinolin-9-ol |
| Manual Xrefs | Databases |
|---|---|
| 8236438 | ChemSpider |
| HMDB0033428 | HMDB |