EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H18N4O3 |
| Net Charge | 0 |
| Average Mass | 254.290 |
| Monoisotopic Mass | 254.13789 |
| SMILES | Cn1cncc1C[C@H](NC(=O)CCCN)C(=O)O |
| InChI | InChI=1S/C11H18N4O3/c1-15-7-13-6-8(15)5-9(11(17)18)14-10(16)3-2-4-12/h6-7,9H,2-5,12H2,1H3,(H,14,16)(H,17,18)/t9-/m0/s1 |
| InChIKey | HXBKNURIXGGFCX-VIFPVBQESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2633) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Homoanserine (CHEBI:172495) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-2-(4-aminobutanoylamino)-3-(3-methylimidazol-4-yl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 17216339 | ChemSpider |
| HMDB0005767 | HMDB |