EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H8O.C7H10O6 |
| Net Charge | 0 |
| Average Mass | 250.247 |
| Monoisotopic Mass | 250.10525 |
| SMILES | CC(=O)CC(O)(CC(=O)O)C(=O)O.CC(C)O |
| InChI | InChI=1S/C7H10O6.C3H8O/c1-4(8)2-7(13,6(11)12)3-5(9)10;1-3(2)4/h13H,2-3H2,1H3,(H,9,10)(H,11,12);3-4H,1-2H3 |
| InChIKey | XBLJCYOUYPSETL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2633) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Isopropyl citrate (CHEBI:172491) is a oxo carboxylic acid (CHEBI:25754) |
| IUPAC Name |
|---|
| 2-hydroxy-2-(2-oxopropyl)butanedioic acid;propan-2-ol |
| Manual Xrefs | Databases |
|---|---|
| 55836 | ChemSpider |
| HMDB0032353 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:39413-05-3 | ChemIDplus |