EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H20N4O6 |
| Net Charge | 0 |
| Average Mass | 304.303 |
| Monoisotopic Mass | 304.13828 |
| SMILES | N=C(N)NCCC[C@H](N[C@H](CCC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C11H20N4O6/c12-11(13)14-5-1-2-6(9(18)19)15-7(10(20)21)3-4-8(16)17/h6-7,15H,1-5H2,(H,16,17)(H,18,19)(H,20,21)(H4,12,13,14)/t6-,7+/m0/s1 |
| InChIKey | LMKYZBGVKHTLTN-NKWVEPMBSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-nopaline (CHEBI:17249) is a D-glutamic acid derivative (CHEBI:83983) |
| D-nopaline (CHEBI:17249) is a L-arginine derivative (CHEBI:83965) |
| D-nopaline (CHEBI:17249) is a amino acid opine (CHEBI:83229) |
| D-nopaline (CHEBI:17249) is a guanidines (CHEBI:24436) |
| D-nopaline (CHEBI:17249) is a secondary amino compound (CHEBI:50995) |
| D-nopaline (CHEBI:17249) is a tricarboxylic acid (CHEBI:27093) |
| D-nopaline (CHEBI:17249) is conjugate acid of D-nopalinate(1−) (CHEBI:58074) |
| Incoming Relation(s) |
| D-nopalinate(1−) (CHEBI:58074) is conjugate base of D-nopaline (CHEBI:17249) |
| IUPAC Names |
|---|
| N-[(1S)-4-carbamimidamido-1-carboxybutyl]-D-glutamic acid |
| (2R)-2-{[(1S)-4-carbamimidamido-1-carboxybutyl]amino}pentanedioic acid |
| Synonyms | Source |
|---|---|
| D-Nopaline | KEGG COMPOUND |
| N-[4-[(Aminoiminomethyl)amino]-1-carboxybutyl]-D-glutamic acid(ECL) | KEGG COMPOUND |
| N2-(D-1,3-Dicarboxypropyl)-L-arginine | KEGG COMPOUND |
| Nopaline | KEGG COMPOUND |
| N2-(D-1,3-dicarboxypropyl)-L-arginine | IUBMB |
| (S)-N-(4-((Aminoiminomethyl)amino)-1-carboxybutyl)-D-glutamic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:22350-70-5 | KEGG COMPOUND |
| CAS:22350-70-5 | ChemIDplus |