EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H14N2O2 |
| Net Charge | 0 |
| Average Mass | 230.267 |
| Monoisotopic Mass | 230.10553 |
| SMILES | CC1NC(C(=O)O)Cc2c1nc1ccccc21 |
| InChI | InChI=1S/C13H14N2O2/c1-7-12-9(6-11(14-7)13(16)17)8-4-2-3-5-10(8)15-12/h2-5,7,11,14-15H,6H2,1H3,(H,16,17) |
| InChIKey | ZUPHXNBLQCSEIA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2633) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1xi,3xi)-1,2,3,4-Tetrahydro-1-methyl-beta-carboline-3-carboxylic acid (CHEBI:172470) is a harmala alkaloid (CHEBI:61379) |
| IUPAC Name |
|---|
| 1-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0037942 | HMDB |
| 66213 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:5470-37-1 | ChemIDplus |