EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14O2S2 |
| Net Charge | 0 |
| Average Mass | 230.354 |
| Monoisotopic Mass | 230.04352 |
| SMILES | CC1=C(SSC2=C(C)OCC2)CCO1 |
| InChI | InChI=1S/C10H14O2S2/c1-7-9(3-5-11-7)13-14-10-4-6-12-8(10)2/h3-6H2,1-2H3 |
| InChIKey | KMPMFKJGGUSVMW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2633) |
| Roles Classification |
|---|
| Chemical Roles: | flavouring agent A food additive that is used to added improve the taste or odour of a food. Maillard reaction product Any thermal degradation product obtained as a result of a chemical reaction between an amino acid and a reducing sugar (Maillard reaction, a non-enzymatic browning procedure that usually imparts flavour to starch-based food products). |
| Biological Roles: | flavouring agent A food additive that is used to added improve the taste or odour of a food. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bis(2-methyl-4,5-dihydro-3-furyl) disulfide (CHEBI:172469) has role flavouring agent (CHEBI:35617) |
| bis(2-methyl-4,5-dihydro-3-furyl) disulfide (CHEBI:172469) has role human metabolite (CHEBI:77746) |
| bis(2-methyl-4,5-dihydro-3-furyl) disulfide (CHEBI:172469) has role Maillard reaction product (CHEBI:77523) |
| bis(2-methyl-4,5-dihydro-3-furyl) disulfide (CHEBI:172469) is a dihydrofuran (CHEBI:51659) |
| bis(2-methyl-4,5-dihydro-3-furyl) disulfide (CHEBI:172469) is a organic disulfide (CHEBI:35489) |
| IUPAC Name |
|---|
| 4,4'-disulfanediylbis(5-methyl-2,3-dihydrofuran) |
| Synonyms | Source |
|---|---|
| 3,3'-dithiobis[4,5-dihydro-2-methylfuran] | ChEBI |
| 4,4'-dithiobis(5-methyl-2,3-dihydrofuran) | IUPAC |
| 5-methyl-4-[(5-methyl-2,3-dihydrofuran-4-yl)disulfanyl]-2,3-dihydrofuran | ChEBI |
| bis(2-methyl-4,5-dihydro-3-furyl)disulfide | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 458716 | ChemSpider |
| FDB019299 | FooDB |
| HMDB0039670 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:85196-66-3 | HMDB |