EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H13NO3 |
| Net Charge | 0 |
| Average Mass | 219.240 |
| Monoisotopic Mass | 219.08954 |
| SMILES | COc1ccc2nc(C)c(CC(=O)O)c2c1 |
| InChI | InChI=1S/C12H13NO3/c1-7-9(6-12(14)15)10-5-8(16-2)3-4-11(10)13-7/h3-5,13H,6H2,1-2H3,(H,14,15) |
| InChIKey | TXWGINUZLBAKDF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2633) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-Deschlorobenzoyl indomethacin (CHEBI:172459) is a indole-3-acetic acids (CHEBI:24803) |
| IUPAC Name |
|---|
| 2-(5-methoxy-2-methyl-1H-indol-3-yl)acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 68635 | ChemSpider |
| HMDB0013988 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:2882-15-7 | ChemIDplus |