EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H12N4O3 |
| Net Charge | 0 |
| Average Mass | 212.209 |
| Monoisotopic Mass | 212.09094 |
| SMILES | NCC(=O)NC(Cc1cncn1)C(=O)O |
| InChI | InChI=1S/C8H12N4O3/c9-2-7(13)12-6(8(14)15)1-5-3-10-4-11-5/h3-4,6H,1-2,9H2,(H,10,11)(H,12,13)(H,14,15) |
| InChIKey | YIWFXZNIBQBFHR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2633) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Glycyl-Histidine (CHEBI:172454) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| 2-[(2-aminoacetyl)amino]-3-(1H-imidazol-5-yl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 369451 | ChemSpider |
| HMDB0028843 | HMDB |