EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H13NO4S |
| Net Charge | 0 |
| Average Mass | 207.251 |
| Monoisotopic Mass | 207.05653 |
| SMILES | CC(CSCC(N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C7H13NO4S/c1-4(6(9)10)2-13-3-5(8)7(11)12/h4-5H,2-3,8H2,1H3,(H,9,10)(H,11,12) |
| InChIKey | QSPWUNSFUXUUDG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2633) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R,2'S)-Isobuteine (CHEBI:172450) is a cysteine derivative (CHEBI:23509) |
| (2R,2'S)-Isobuteine (CHEBI:172450) is a dicarboxylic acid (CHEBI:35692) |
| (2R,2'S)-Isobuteine (CHEBI:172450) is a organic sulfide (CHEBI:16385) |
| IUPAC Name |
|---|
| 3-(2-amino-2-carboxyethyl)sulanyl-2-methylpropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 13664198 | ChemSpider |
| HMDB0030411 | HMDB |