EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8O7 |
| Net Charge | 0 |
| Average Mass | 204.134 |
| Monoisotopic Mass | 204.02700 |
| SMILES | O=C(O)C1=CC(O)C(O)C(C(=O)O)O1 |
| InChI | InChI=1S/C7H8O7/c8-2-1-3(6(10)11)14-5(4(2)9)7(12)13/h1-2,4-5,8-9H,(H,10,11)(H,12,13) |
| InChIKey | KUKCUROTFRBUNU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2633) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Daucic acid (CHEBI:172444) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| IUPAC Name |
|---|
| 3,4-dihydroxy-3,4-dihydro-2H-pyran-2,6-dicarboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0031665 | HMDB |
| 4475394 | ChemSpider |