EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H18N2O2 |
| Net Charge | 0 |
| Average Mass | 174.244 |
| Monoisotopic Mass | 174.13683 |
| SMILES | CN(C)CCCCC(N)C(=O)O |
| InChI | InChI=1S/C8H18N2O2/c1-10(2)6-4-3-5-7(9)8(11)12/h7H,3-6,9H2,1-2H3,(H,11,12) |
| InChIKey | XXEWFEBMSGLYBY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2633) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ne,Ne dimethyllysine (CHEBI:172425) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 2-amino-6-(dimethylamino)hexanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 3676766 | ChemSpider |
| C05545 | KEGG COMPOUND |
| CPD-8900 | MetaCyc |
| HMDB0013287 | HMDB |