EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H9N3O2 |
| Net Charge | 0 |
| Average Mass | 167.168 |
| Monoisotopic Mass | 167.06948 |
| SMILES | O=C(O)C1Cc2ncnc2CN1 |
| InChI | InChI=1S/C7H9N3O2/c11-7(12)5-1-4-6(2-8-5)10-3-9-4/h3,5,8H,1-2H2,(H,9,10)(H,11,12) |
| InChIKey | YCFJXOFFQLPCHD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2633) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-Spinacine (CHEBI:172422) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine-6-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 323081 | ChemSpider |
| HMDB0029873 | HMDB |