EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H17NO3 |
| Net Charge | 0 |
| Average Mass | 247.294 |
| Monoisotopic Mass | 247.12084 |
| SMILES | CC(O)CCCn1cc(C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C14H17NO3/c1-10(16)5-4-8-15-9-12(14(17)18)11-6-2-3-7-13(11)15/h2-3,6-7,9-10,16H,4-5,8H2,1H3,(H,17,18) |
| InChIKey | JKTRSAHBYMWKAA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas aeruginosa (ncbitaxon:287) | |||
| Culture media, conditioned (OMIT:0017487) | MetaboLights (MTBLS2105) | ||
| Culture media, conditioned (OMIT:0017487) | MetaboLights (MTBLS2105) | Strain: Pseudomonas aeruginosa UCBPP-PA14 [NCBI:txid208963] | |
| Pseudomonas aeruginosa;Staphylococcus aureus (ncbitaxon:1280) | Culture media, conditioned (OMIT:0017487) | MetaboLights (MTBLS2105) | |
| Staphylococcus aureus (ncbitaxon:1280) | |||
| Culture media, conditioned (OMIT:0017487) | MetaboLights (MTBLS2105) | Strain: Staphylococcus aureus subsp. aureus USA300 [NCBI:txid367830] | |
| Culture media, conditioned (OMIT:0017487) | MetaboLights (MTBLS2105) | ||
| unidentified (ncbitaxon:32644) | Culture media, conditioned (OMIT:0017487) | MetaboLights (MTBLS2105) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(4-Hydroxypentyl)-3-carboxyindole (CHEBI:172379) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| 1-(4-hydroxypentyl)indole-3-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 29341627 | ChemSpider |