EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16N4O5 |
| Net Charge | 0 |
| Average Mass | 308.294 |
| Monoisotopic Mass | 308.11207 |
| SMILES | [H][C@@]1(C(=O)N[C@@H](CC(N)=O)C(=O)O)C=CC2=CC[C@H](N)C(=O)N21 |
| InChI | InChI=1S/C13H16N4O5/c14-7-3-1-6-2-4-9(17(6)12(7)20)11(19)16-8(13(21)22)5-10(15)18/h1-2,4,7-9H,3,5,14H2,(H2,15,18)(H,16,19)(H,21,22)/t7-,8-,9-/m0/s1 |
| InChIKey | XSESHFKIXVTLOJ-CIUDSAMLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pantoea agglomerans (ncbitaxon:549) | |||
| - | PubMed (32416447) | Strain: Tx10 | |
| - | PubMed (11133457) | Strain: Eh318 | |
| - | PubMed (30868174) | Strain: E325 | |
| - | PubMed (30868174) | Strain: P10c | |
| Pantoea vagans (ncbitaxon:712898) | - | PubMed (30868174) | Strain: C9-1 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 2.6.1.11 (acetylornithine transaminase) inhibitor An EC 2.6.1.* (transaminase) inhibitor that interferes with the action of acetylornithine transaminase (EC 2.6.1.11). antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pantocin A (CHEBI:172375) has role antibacterial agent (CHEBI:33282) |
| pantocin A (CHEBI:172375) has role bacterial metabolite (CHEBI:76969) |
| pantocin A (CHEBI:172375) has role EC 2.6.1.11 (acetylornithine transaminase) inhibitor (CHEBI:172919) |
| pantocin A (CHEBI:172375) is a indolizines (CHEBI:38485) |
| pantocin A (CHEBI:172375) is a monocarboxylic acid (CHEBI:25384) |
| pantocin A (CHEBI:172375) is a primary amino compound (CHEBI:50994) |
| pantocin A (CHEBI:172375) is a primary carboxamide (CHEBI:140324) |
| pantocin A (CHEBI:172375) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| N2-{[(3S,6S)-6-amino-5-oxo-3,5,6,7-tetrahydroindolizin-3-yl]carbonyl}-L-asparagine |
| Synonym | Source |
|---|---|
| (2S)-4-amino-2-({[(3S,6S)-6-amino-5-oxo-3,5,6,7-tetrahydroindolizin-3-yl]carbonyl}amino)-4-oxobutanoic acid | IUPAC |
| Citations |
|---|