EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H13NO2 |
| Net Charge | 0 |
| Average Mass | 143.186 |
| Monoisotopic Mass | 143.09463 |
| SMILES | C[N+](C)(C)C/C=C/C(=O)[O-] |
| InChI | InChI=1S/C7H13NO2/c1-8(2,3)6-4-5-7(9)10/h4-5H,6H2,1-3H3/b5-4+ |
| InChIKey | GUYHPGUANSLONG-SNAWJCMRSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-4-(trimethylammonio)but-2-enoate (CHEBI:17237) is a 4-(trimethylammonio)but-2-enoate (CHEBI:11946) |
| (E)-4-(trimethylammonio)but-2-enoate (CHEBI:17237) is conjugate base of (E)-4-(trimethylammonio)but-2-enoic acid (CHEBI:1774) |
| Incoming Relation(s) |
| (E)-4-(trimethylammonio)but-2-enoic acid (CHEBI:1774) is conjugate acid of (E)-4-(trimethylammonio)but-2-enoate (CHEBI:17237) |
| IUPAC Name |
|---|
| (2E)-4-(trimethylammonio)but-2-enoate |
| Synonyms | Source |
|---|---|
| crotonic acid betaine | ChemIDplus |
| croton betaine | ChemIDplus |
| crotonobetaine | ChemIDplus |
| (3-carboxyallyl)trimethylammonium hydroxide, inner salt | ChemIDplus |
| Crotonsäurebetain | ChemIDplus |
| UniProt Name | Source |
|---|---|
| crotonobetaine | UniProt |