EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H38N2O5 |
| Net Charge | 0 |
| Average Mass | 542.676 |
| Monoisotopic Mass | 542.27807 |
| SMILES | [H][C@@]12[C@H](C)[C@@]3(C)O[C@H]3[C@]3([H])/C=C/C[C@H](C)/C=C(/C)[C@@H](O)C(=O)/C=C/C(=O)[C@@]13C(=O)N[C@@]2([H])[C@H](C)c1cnc2ccccc12 |
| InChI | InChI=1S/C33H38N2O5/c1-17-9-8-11-23-30-32(5,40-30)20(4)27-28(19(3)22-16-34-24-12-7-6-10-21(22)24)35-31(39)33(23,27)26(37)14-13-25(36)29(38)18(2)15-17/h6-8,10-17,19-20,23,27-30,34,38H,9H2,1-5H3,(H,35,39)/b11-8+,14-13+,18-15-/t17-,19+,20-,23-,27-,28-,29+,30-,32+,33+/m0/s1 |
| InChIKey | YLBJYVFDYOTYHW-QLDXQYSGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Discosia rubi (ncbitaxon:2502037) | - | PubMed (32849391) | Strain: TTI-0885 |
| Discosia sp. (ncbitaxon:1715227) | - | DOI (10.1080/10575639708043695) | Strain: TCF 9535 |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chaetoglobosin P (CHEBI:172345) has functional parent chaetoglobosin A (CHEBI:68798) |
| chaetoglobosin P (CHEBI:172345) has role antifungal agent (CHEBI:35718) |
| chaetoglobosin P (CHEBI:172345) is a cytochalasan alkaloid (CHEBI:75946) |
| chaetoglobosin P (CHEBI:172345) is a epoxide (CHEBI:32955) |
| chaetoglobosin P (CHEBI:172345) is a indoles (CHEBI:24828) |
| chaetoglobosin P (CHEBI:172345) is a macrocycle (CHEBI:51026) |
| chaetoglobosin P (CHEBI:172345) is a secondary α-hydroxy ketone (CHEBI:2468) |
| IUPAC Name |
|---|
| (1E,4S,5Z,7R,9E,11aR,14S,14aR,15S,15aR,16aS,16bR)-7-hydroxy-14-[(1R)-1-(1H-indol-3-yl)ethyl]-4,6,15,15a-tetramethyl-4,7,14,14a,15,15a,16a,16b-octahydro-3H-cyclotrideca[d]oxireno[f]isoindole-8,11,12(13H)-trione |
| Registry Numbers | Sources |
|---|---|
| CAS:191403-93-7 | ChEBI |
| Citations |
|---|