EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H28N6O2 |
| Net Charge | 0 |
| Average Mass | 444.539 |
| Monoisotopic Mass | 444.22737 |
| SMILES | O=C(NCc1cn2cc(CNCC3CCCCC3)ccc2n1)c1cc(=O)n2ccccc2n1 |
| InChI | InChI=1S/C25H28N6O2/c32-24-12-21(29-23-8-4-5-11-31(23)24)25(33)27-15-20-17-30-16-19(9-10-22(30)28-20)14-26-13-18-6-2-1-3-7-18/h4-5,8-12,16-18,26H,1-3,6-7,13-15H2,(H,27,33) |
| InChIKey | OBERVORNENYOLE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 2.1.1.348 (mRNA m6A methyltransferase) inhibitor An EC 2.1.1.* (methyltransferases) inhibitor that interferes with the action of mRNA m6A methyltransferase (EC 2.1.1.348). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| STM2457 (CHEBI:172325) has role antineoplastic agent (CHEBI:35610) |
| STM2457 (CHEBI:172325) has role apoptosis inducer (CHEBI:68495) |
| STM2457 (CHEBI:172325) has role EC 2.1.1.348 (mRNA m6A methyltransferase) inhibitor (CHEBI:172326) |
| STM2457 (CHEBI:172325) is a imidazopyridine (CHEBI:46908) |
| STM2457 (CHEBI:172325) is a pyridopyrimidine (CHEBI:38932) |
| STM2457 (CHEBI:172325) is a secondary amino compound (CHEBI:50995) |
| STM2457 (CHEBI:172325) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| N-[(6-{[(cyclohexylmethyl)amino]methyl}imidazo[1,2-a]pyridin-2-yl)methyl]-4-oxo-4H-pyrido[1,2-a]pyrimidine-2-carboxamide |
| Synonyms | Source |
|---|---|
| STM 2457 | ChEBI |
| STM-2457 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| WO2020201773 | Patent |
| Citations |
|---|