EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:17221 - β-myrcene
| Formula | C10H16 |
| Net Charge | 0 |
| Average Mass | 136.238 |
| Monoisotopic Mass | 136.12520 |
| SMILES | C=CC(=C)CCC=C(C)C |
| InChI | InChI=1S/C10H16/c1-5-10(4)8-6-7-9(2)3/h5,7H,1,4,6,8H2,2-3H3 |
| InChIKey | UAHWPYUMFXYFJY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Angelica pubescens (ncbitaxon:312530) | - | Article (Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).) | |
| Bupleurum chinense (ncbitaxon:52451) | - | Article (Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).) | |
| Guatteriopsis hispida (ncbitaxon:402570) | - | Article (Costa,Phytochem.,69,(2008),1895) |
| Roles Classification |
|---|
| Biological Roles: | flavouring agent A food additive that is used to added improve the taste or odour of a food. anabolic agent A compound which stimulates anabolism and inhibits catabolism. Anabolic agents stimulate the development of muscle mass, strength, and power. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | flavouring agent A food additive that is used to added improve the taste or odour of a food. anti-inflammatory agent Any compound that has anti-inflammatory effects. fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-myrcene (CHEBI:17221) has role anabolic agent (CHEBI:36413) |
| β-myrcene (CHEBI:17221) has role anti-inflammatory agent (CHEBI:67079) |
| β-myrcene (CHEBI:17221) has role flavouring agent (CHEBI:35617) |
| β-myrcene (CHEBI:17221) has role fragrance (CHEBI:48318) |
| β-myrcene (CHEBI:17221) has role plant metabolite (CHEBI:76924) |
| β-myrcene (CHEBI:17221) has role volatile oil component (CHEBI:27311) |
| β-myrcene (CHEBI:17221) is a monoterpene (CHEBI:35187) |
| IUPAC Name |
|---|
| 7-methyl-3-methylideneocta-1,6-diene |
| Synonyms | Source |
|---|---|
| 7-methyl-3-methylene-1,6-octadiene | NIST Chemistry WebBook |
| 7-methyl-3-methyleneocta-1,6-diene | IUBMB |
| beta-Myrcene | KEGG COMPOUND |
| Myrcene | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| β-myrcene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00000853 | KNApSAcK |
| C06074 | KEGG COMPOUND |
| CPD-4888 | MetaCyc |
| HMDB0038169 | HMDB |
| LMPR0102010005 | LIPID MAPS |
| Myrcene | Wikipedia |
| Citations |
|---|