EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H27N7O |
| Net Charge | 0 |
| Average Mass | 393.495 |
| Monoisotopic Mass | 393.22771 |
| SMILES | CC[C@H](C)C(=O)Nc1ncc(-c2cnc3ccccc23)nc1CCCNC(=N)N |
| InChI | InChI=1S/C21H27N7O/c1-3-13(2)20(29)28-19-17(9-6-10-24-21(22)23)27-18(12-26-19)15-11-25-16-8-5-4-7-14(15)16/h4-5,7-8,11-13,25H,3,6,9-10H2,1-2H3,(H4,22,23,24)(H,26,28,29)/t13-/m0/s1 |
| InChIKey | PSYJEEMZZIZTSR-ZDUSSCGKSA-N |
| Roles Classification |
|---|
| Chemical Roles: | luciferin A low-molecular-mass compound present in bioluminescent organisms that emits light when oxidized in presence of enzyme luciferase. |
| Biological Roles: | luciferin A low-molecular-mass compound present in bioluminescent organisms that emits light when oxidized in presence of enzyme luciferase. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxidized Cypridina luciferin (CHEBI:17216) has role oxidized luciferins (CHEBI:25747) |
| oxidized Cypridina luciferin (CHEBI:17216) is a Cypridina luciferin (CHEBI:17073) |
| oxidized Cypridina luciferin (CHEBI:17216) is a guanidines (CHEBI:24436) |
| oxidized Cypridina luciferin (CHEBI:17216) is a pyrazines (CHEBI:38314) |
| oxidized Cypridina luciferin (CHEBI:17216) is conjugate base of oxidized Cypridina luciferin(1+) (CHEBI:58059) |
| Incoming Relation(s) |
| oxidized Cypridina luciferin(1+) (CHEBI:58059) is conjugate acid of oxidized Cypridina luciferin (CHEBI:17216) |
| IUPAC Name |
|---|
| 1-(3-{6-(1H-indol-3-yl)-3-[(2S)-2-methylbutanamido]pyrazin-2-yl}propyl)guanidine |
| Synonym | Source |
|---|---|
| Oxidized Cypridina luciferin | KEGG COMPOUND |