EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H28N2O3 |
| Net Charge | 0 |
| Average Mass | 272.389 |
| Monoisotopic Mass | 272.20999 |
| SMILES | CCCCCCCC(=O)NCCCCC(N)C(=O)O |
| InChI | InChI=1S/C14H28N2O3/c1-2-3-4-5-6-10-13(17)16-11-8-7-9-12(15)14(18)19/h12H,2-11,15H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | DUZODDYGMSCYMJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| blood plasma (BTO:0000131) | MetaboLights (MTBLS2128) | ||
| Pooled sample (NCIT:C45910) | MetaboLights (MTBLS2128) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N(6)-(Octanoyl)lysine (CHEBI:172138) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 2-amino-6-(octanoylamino)hexanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 35032089 | ChemSpider |
| HMDB0011684 | HMDB |