EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H34O3 |
| Net Charge | 0 |
| Average Mass | 298.467 |
| Monoisotopic Mass | 298.25079 |
| SMILES | CCCCCCCCC(=O)CCCCCCCCC(=O)O |
| InChI | InChI=1S/C18H34O3/c1-2-3-4-5-8-11-14-17(19)15-12-9-6-7-10-13-16-18(20)21/h2-16H2,1H3,(H,20,21) |
| InChIKey | BGKROBBCCGUUCF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| blood plasma (BTO:0000131) | MetaboLights (MTBLS2128) | ||
| Pooled sample (NCIT:C45910) | MetaboLights (MTBLS2128) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 10-Oxooctadecanoic acid (CHEBI:172116) is a long-chain fatty acid (CHEBI:15904) |
| 10-Oxooctadecanoic acid (CHEBI:172116) is conjugate acid of 10-KOMA(1−) (CHEBI:194437) |
| Incoming Relation(s) |
| 10-KOMA(1−) (CHEBI:194437) is conjugate base of 10-Oxooctadecanoic acid (CHEBI:172116) |
| IUPAC Name |
|---|
| 10-oxooctadecanoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0030980 | HMDB |
| 321290 | ChemSpider |
| KTC | PDBeChem |
| LMFA01060066 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:4158-12-7 | ChemIDplus |