EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:172109 - bis(2-methyl-3-furyl)disulfide
| Formula | C10H10O2S2 |
| Net Charge | 0 |
| Average Mass | 226.322 |
| Monoisotopic Mass | 226.01222 |
| SMILES | Cc1occc1SSc1ccoc1C |
| InChI | InChI=1S/C10H10O2S2/c1-7-9(3-5-11-7)13-14-10-4-6-12-8(10)2/h3-6H,1-2H3 |
| InChIKey | OHDFENKFSKIFBJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| blood plasma (BTO:0000131) | MetaboLights (MTBLS2128) | ||
| Pooled sample (NCIT:C45910) | MetaboLights (MTBLS2128) | ||
| Anacardium occidentale (ncbitaxon:171929) | - | PubMed (12568564) | Identified in cashew apple nectar. |
| Camellia sinensis (ncbitaxon:4442) | - | PubMed (30372917) |
| Roles Classification |
|---|
| Chemical Role: | Maillard reaction product Any thermal degradation product obtained as a result of a chemical reaction between an amino acid and a reducing sugar (Maillard reaction, a non-enzymatic browning procedure that usually imparts flavour to starch-based food products). |
| Biological Roles: | mammalian metabolite Any animal metabolite produced during a metabolic reaction in mammals. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). flavouring agent A food additive that is used to added improve the taste or odour of a food. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bis(2-methyl-3-furyl)disulfide (CHEBI:172109) has role flavouring agent (CHEBI:35617) |
| bis(2-methyl-3-furyl)disulfide (CHEBI:172109) has role human metabolite (CHEBI:77746) |
| bis(2-methyl-3-furyl)disulfide (CHEBI:172109) has role Maillard reaction product (CHEBI:77523) |
| bis(2-methyl-3-furyl)disulfide (CHEBI:172109) has role mammalian metabolite (CHEBI:75768) |
| bis(2-methyl-3-furyl)disulfide (CHEBI:172109) has role plant metabolite (CHEBI:76924) |
| bis(2-methyl-3-furyl)disulfide (CHEBI:172109) is a furans (CHEBI:24129) |
| bis(2-methyl-3-furyl)disulfide (CHEBI:172109) is a organic disulfide (CHEBI:35489) |
| IUPAC Name |
|---|
| 3,3'-disulfanediylbis(2-methylfuran) |
| Synonyms | Source |
|---|---|
| bis(2-methyl-3-furyl) disulfide | ChemIDplus |
| 3,3'-dithio-2,2'-dimethyldifuran | ChemIDplus |
| 3,3'-dithiobis(2-methylfuran) | ChemIDplus |
| bis(2-methyl-3-furyl)disulphide | NIST Chemistry WebBook |
| bis(2-methyl-3-furanyl) disulfide | NIST Chemistry WebBook |
| bis(2-methyl-3-furyl)disulfide | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0040201 | HMDB |
| 459081 | ChemSpider |
| FDB019913 | FooDB |
| Registry Numbers | Sources |
|---|---|
| CAS:28588-75-2 | ChemIDplus |
| CAS:28588-75-2 | NIST Chemistry WebBook |
| Citations |
|---|