EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:172083 - (?)-Camphoric acid
| Formula | C10H16O4 |
| Net Charge | 0 |
| Average Mass | 200.234 |
| Monoisotopic Mass | 200.10486 |
| SMILES | CC1(C)[C@@H](C(=O)O)CC[C@@]1(C)C(=O)O |
| InChI | InChI=1S/C10H16O4/c1-9(2)6(7(11)12)4-5-10(9,3)8(13)14/h6H,4-5H2,1-3H3,(H,11,12)(H,13,14)/t6-,10+/m1/s1 |
| InChIKey | LSPHULWDVZXLIL-LDWIPMOCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| Pooled sample (NCIT:C45910) | MetaboLights (MTBLS2128) | ||
| blood plasma (BTO:0000131) | MetaboLights (MTBLS2128) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (?)-Camphoric acid (CHEBI:172083) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| (1R,3S)-1,2,2-trimethylcyclopentane-1,3-dicarboxylic acid |