EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H20O2 |
| Net Charge | 0 |
| Average Mass | 184.279 |
| Monoisotopic Mass | 184.14633 |
| SMILES | CC/C=C\CCOC(=O)CC(C)C |
| InChI | InChI=1S/C11H20O2/c1-4-5-6-7-8-13-11(12)9-10(2)3/h5-6,10H,4,7-9H2,1-3H3/b6-5- |
| InChIKey | AIQLNKITFBJPFO-WAYWQWQTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Artocarpus heterophyllus (ncbitaxon:3489) | aerial part (BTO:0001658) | PubMed (33844147) | Found in fruit arils. |
| Capsicum chinense (ncbitaxon:80379) | - | DOI (10.1016/j.foodchem.2004.11.040) | |
| Gasterophilus pecorum (ncbitaxon:204919) | - | PubMed (32978441) | |
| Homo sapiens (ncbitaxon:9606) | |||
| Pooled sample (NCIT:C45910) | MetaboLights (MTBLS2128) | Strain: | |
| blood plasma (BTO:0000131) | MetaboLights (MTBLS2128) | ||
| Matricaria matricarioides (ncbitaxon:56017) | whole plant (BTO:0001461) | DOI (10.1016/S0031-9422(00)97295-9) | |
| Prunus cerasus (ncbitaxon:140311) | fruit (BTO:0000486) | PubMed (35206687) | |
| Vincetoxicum mongolicum (ncbitaxon:648865) | - | PubMed (24914292) | Species also known as Cynanchum mongolicum. |
| Roles Classification |
|---|
| Chemical Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. insect attractant A chemical that attracts insects. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-3-hexenyl isovalerate (CHEBI:172060) has role insect attractant (CHEBI:24850) |
| cis-3-hexenyl isovalerate (CHEBI:172060) has role volatile oil component (CHEBI:27311) |
| cis-3-hexenyl isovalerate (CHEBI:172060) is a 3-hexenyl isovalerate (CHEBI:194237) |
| IUPAC Name |
|---|
| (3Z)-hex-3-en-1-yl 3-methylbutanoate |
| Synonyms | Source |
|---|---|
| (3Z)-3-hexenyl 3-methylbutanoate | NIST Chemistry WebBook |
| (3Z)-hex-3-enyl 3-methylbutyrate | ChEBI |
| (3Z)-hex-3-enyl isovalerate | ChEBI |
| (3Z)-hexenyl 3-methyl butyrate | ChEBI |
| (3Z)-hexenyl isovalerate | ChEBI |
| 3-methylbutanoic acid (3Z)-3-hexen-1-yl ester | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 4519169 | ChemSpider |
| C00029347 | KNApSAcK |
| FDB017576 | FooDB |
| HMDB0038278 | HMDB |
| LMFA07010592 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2433447 | Reaxys |
| CAS:35154-45-1 | NIST Chemistry WebBook |
| CAS:35154-45-1 | ChemIDplus |
| Citations |
|---|