EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6O5 |
| Net Charge | -2 |
| Average Mass | 170.120 |
| Monoisotopic Mass | 170.02262 |
| SMILES | [H]C(CCC(=O)[O-])=C([H])C(=O)C(=O)[O-] |
| InChI | InChI=1S/C7H8O5/c8-5(7(11)12)3-1-2-4-6(9)10/h1,3H,2,4H2,(H,9,10)(H,11,12)/p-2 |
| InChIKey | HYVSZVZMTYIHKF-UHFFFAOYSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-oxohept-3-enedioate (CHEBI:17205) is a heptenedioate (CHEBI:24521) |
| 2-oxohept-3-enedioate (CHEBI:17205) is conjugate base of 2-oxohept-3-enedioic acid (CHEBI:48061) |
| Incoming Relation(s) |
| 2-oxohept-3-enedioic acid (CHEBI:48061) is conjugate acid of 2-oxohept-3-enedioate (CHEBI:17205) |
| IUPAC Name |
|---|
| 2-oxohept-3-enedioate |
| Synonym | Source |
|---|---|
| 2-oxohept-3-ene-1,7-dioate | ChEBI |