EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O3 |
| Net Charge | 0 |
| Average Mass | 186.251 |
| Monoisotopic Mass | 186.12559 |
| SMILES | C=C(C(=O)OCCC(C)C)C(C)O |
| InChI | InChI=1S/C10H18O3/c1-7(2)5-6-13-10(12)8(3)9(4)11/h7,9,11H,3,5-6H2,1-2,4H3 |
| InChIKey | URBTVTZTLQVLCO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| Pooled sample (NCIT:C45910) | MetaboLights (MTBLS2128) | ||
| blood plasma (BTO:0000131) | MetaboLights (MTBLS2128) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-Methylbutyl 3-hydroxy-2-methylidenebutanoate (CHEBI:171965) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| IUPAC Name |
|---|
| 3-methylbutyl 3-hydroxy-2-methylidenebutanoate |
| Manual Xrefs | Databases |
|---|---|
| 479563 | ChemSpider |
| HMDB0040205 | HMDB |