EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16O3 |
| Net Charge | 0 |
| Average Mass | 172.224 |
| Monoisotopic Mass | 172.10994 |
| SMILES | CC(=O)CC(=O)OCCC(C)C |
| InChI | InChI=1S/C9H16O3/c1-7(2)4-5-12-9(11)6-8(3)10/h7H,4-6H2,1-3H3 |
| InChIKey | XHRGPLDMNNGHCX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| Pooled sample (NCIT:C45910) | MetaboLights (MTBLS2128) | ||
| blood plasma (BTO:0000131) | MetaboLights (MTBLS2128) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-Methylbutyl 3-oxobutanoate (CHEBI:171946) is a oxo carboxylic acid (CHEBI:25754) |
| IUPAC Name |
|---|
| 3-methylbutyl 3-oxobutanoate |
| Manual Xrefs | Databases |
|---|---|
| 55235 | ChemSpider |
| HMDB0036396 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:2308-18-1 | ChemIDplus |