EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16O3 |
| Net Charge | 0 |
| Average Mass | 172.224 |
| Monoisotopic Mass | 172.10994 |
| SMILES | CCCCOC(=O)CCC(C)=O |
| InChI | InChI=1S/C9H16O3/c1-3-4-7-12-9(11)6-5-8(2)10/h3-7H2,1-2H3 |
| InChIKey | ISBWNEKJSSLXOD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| blood plasma (BTO:0000131) | MetaboLights (MTBLS2128) | ||
| Pooled sample (NCIT:C45910) | MetaboLights (MTBLS2128) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Butyl levulinate (CHEBI:171935) is a oxo carboxylic acid (CHEBI:25754) |
| IUPAC Name |
|---|
| butyl 4-oxopentanoate |
| Synonym | Source |
|---|---|
| OI1695000 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 15496 | ChemSpider |
| HMDB0040165 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:2052-15-5 | ChemIDplus |