EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H3Br2NO |
| Net Charge | 0 |
| Average Mass | 276.915 |
| Monoisotopic Mass | 274.85814 |
| SMILES | N#Cc1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C7H3Br2NO/c8-5-1-4(3-10)2-6(9)7(5)11/h1-2,11H |
| InChIKey | UPMXNNIRAGDFEH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,5-dibromo-4-hydroxybenzonitrile (CHEBI:17192) has functional parent 2,6-dibromophenol (CHEBI:19391) |
| 3,5-dibromo-4-hydroxybenzonitrile (CHEBI:17192) has role environmental contaminant (CHEBI:78298) |
| 3,5-dibromo-4-hydroxybenzonitrile (CHEBI:17192) has role herbicide (CHEBI:24527) |
| 3,5-dibromo-4-hydroxybenzonitrile (CHEBI:17192) has role xenobiotic (CHEBI:35703) |
| 3,5-dibromo-4-hydroxybenzonitrile (CHEBI:17192) is a dibromobenzene (CHEBI:37147) |
| 3,5-dibromo-4-hydroxybenzonitrile (CHEBI:17192) is a hydroxynitrile (CHEBI:24730) |
| 3,5-dibromo-4-hydroxybenzonitrile (CHEBI:17192) is a phenols (CHEBI:33853) |
| 3,5-dibromo-4-hydroxybenzonitrile (CHEBI:17192) is conjugate acid of 3,5-dibromo-4-oxidobenzonitrile(1−) (CHEBI:58046) |
| Incoming Relation(s) |
| 3,5-dibromo-4-oxidobenzonitrile(1−) (CHEBI:58046) is conjugate base of 3,5-dibromo-4-hydroxybenzonitrile (CHEBI:17192) |
| IUPAC Name |
|---|
| 3,5-dibromo-4-hydroxybenzonitrile |
| Synonyms | Source |
|---|---|
| 3,5-Dibromo-4-hydroxybenzonitrile | KEGG COMPOUND |
| 2,6-dibromo-4-cyanophenol | NIST Chemistry WebBook |
| bromoxynil | ChemIDplus |
| 3,5-Dibromo-4-hydroxybenzonitrile | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C04178 | KEGG COMPOUND |
| c0480 | UM-BBD |
| Bromoxynil | Wikipedia |
| bromoxynil | Alan Wood's Pesticides |
| 96 | PPDB |
| Citations |
|---|