EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H20O2 |
| Net Charge | 0 |
| Average Mass | 184.279 |
| Monoisotopic Mass | 184.14633 |
| SMILES | CCCCCCC1CC1CC(=O)O |
| InChI | InChI=1S/C11H20O2/c1-2-3-4-5-6-9-7-10(9)8-11(12)13/h9-10H,2-8H2,1H3,(H,12,13) |
| InChIKey | DSMAUFFXECFFMC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| blood plasma (BTO:0000131) | MetaboLights (MTBLS2128) | ||
| Pooled sample (NCIT:C45910) | MetaboLights (MTBLS2128) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-2-Hexyl-1-cyclopropaneacetic acid (CHEBI:171836) is a carboxylic acid (CHEBI:33575) |
| IUPAC Name |
|---|
| 2-(2-hexylcyclopropyl)acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 473227 | ChemSpider |
| HMDB0031087 | HMDB |