EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H17NO3 |
| Net Charge | 0 |
| Average Mass | 223.272 |
| Monoisotopic Mass | 223.12084 |
| SMILES | [H][C@@]1(C(N)=O)O[C@]1([H])C(=O)CC/C=C/C/C=C/C |
| InChI | InChI=1S/C12H17NO3/c1-2-3-4-5-6-7-8-9(14)10-11(16-10)12(13)15/h2-3,5-6,10-11H,4,7-8H2,1H3,(H2,13,15)/b3-2+,6-5+/t10-,11-/m1/s1 |
| InChIKey | GVEZIHKRYBHEFX-NQQPLRFYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. fatty acid synthesis inhibitor Any pathway inhibitor that inhibits the synthesis of fatty acids. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antilipemic drug A substance used to treat hyperlipidemia (an excess of lipids in the blood). antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cerulenin (CHEBI:171741) has role antifungal agent (CHEBI:35718) |
| cerulenin (CHEBI:171741) has role antiinfective agent (CHEBI:35441) |
| cerulenin (CHEBI:171741) has role antilipemic drug (CHEBI:35679) |
| cerulenin (CHEBI:171741) has role antimetabolite (CHEBI:35221) |
| cerulenin (CHEBI:171741) has role antimicrobial agent (CHEBI:33281) |
| cerulenin (CHEBI:171741) has role fatty acid synthesis inhibitor (CHEBI:50185) |
| cerulenin (CHEBI:171741) is a epoxide (CHEBI:32955) |
| cerulenin (CHEBI:171741) is a monocarboxylic acid amide (CHEBI:29347) |
| IUPAC Name |
|---|
| (2R,3S)-3-[(4E,7E)-nona-4,7-dienoyl]oxirane-2-carboxamide |
| Synonyms | Source |
|---|---|
| (2R,3S)-3-((4E,7E)-nona-4,7-dienoyl)oxirane-2-carboxamide | ChEMBL |
| (2R,3S)-3-((4E,7E)-Nona-4,7-dienoyl)-oxirane-2-carboxylic acid amide | ChEMBL |
| (+)-cerulenin | ChEBI |
| Cerulenin | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4807182 | Beilstein |
| CAS:17397-89-6 | KEGG COMPOUND |
| CAS:17397-89-6 | ChemIDplus |
| Citations |
|---|