EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H17NO3 |
| Net Charge | 0 |
| Average Mass | 223.272 |
| Monoisotopic Mass | 223.12084 |
| SMILES | [H][C@@]1(C(N)=O)O[C@]1([H])C(=O)CC/C=C/C/C=C/C |
| InChI | InChI=1S/C12H17NO3/c1-2-3-4-5-6-7-8-9(14)10-11(16-10)12(13)15/h2-3,5-6,10-11H,4,7-8H2,1H3,(H2,13,15)/b3-2+,6-5+/t10-,11-/m1/s1 |
| InChIKey | GVEZIHKRYBHEFX-NQQPLRFYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. fatty acid synthesis inhibitor Any pathway inhibitor that inhibits the synthesis of fatty acids. antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. |
| Applications: | antilipemic drug A substance used to treat hyperlipidemia (an excess of lipids in the blood). antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cerulenin (CHEBI:171741) has role antifungal agent (CHEBI:35718) |
| cerulenin (CHEBI:171741) has role antiinfective agent (CHEBI:35441) |
| cerulenin (CHEBI:171741) has role antilipemic drug (CHEBI:35679) |
| cerulenin (CHEBI:171741) has role antimetabolite (CHEBI:35221) |
| cerulenin (CHEBI:171741) has role antimicrobial agent (CHEBI:33281) |
| cerulenin (CHEBI:171741) has role fatty acid synthesis inhibitor (CHEBI:50185) |
| cerulenin (CHEBI:171741) is a epoxide (CHEBI:32955) |
| cerulenin (CHEBI:171741) is a monocarboxylic acid amide (CHEBI:29347) |
| IUPAC Name |
|---|
| (2R,3S)-3-[(4E,7E)-nona-4,7-dienoyl]oxirane-2-carboxamide |
| Synonyms | Source |
|---|---|
| (2R,3S)-3-((4E,7E)-nona-4,7-dienoyl)oxirane-2-carboxamide | ChEMBL |
| (2R,3S)-3-((4E,7E)-Nona-4,7-dienoyl)-oxirane-2-carboxylic acid amide | ChEMBL |
| (+)-cerulenin | ChEBI |
| Cerulenin | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4807182 | Beilstein |
| CAS:17397-89-6 | KEGG COMPOUND |
| CAS:17397-89-6 | ChemIDplus |
| Citations |
|---|