EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H24O3 |
| Net Charge | 0 |
| Average Mass | 216.321 |
| Monoisotopic Mass | 216.17254 |
| SMILES | CCCCCCCC(O)CCCC(=O)O |
| InChI | InChI=1S/C12H24O3/c1-2-3-4-5-6-8-11(13)9-7-10-12(14)15/h11,13H,2-10H2,1H3,(H,14,15) |
| InChIKey | LXNOENXQFNYMGT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| blood plasma (BTO:0000131) | MetaboLights (MTBLS2128) | ||
| Pooled sample (NCIT:C45910) | MetaboLights (MTBLS2128) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| xi-5-Hydroxydodecanoic acid (CHEBI:171725) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| 5-hydroxydodecanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 22928 | ChemSpider |
| HMDB0040169 | HMDB |
| LMFA01050529 | LIPID MAPS |