EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H41NO5 |
| Net Charge | 0 |
| Average Mass | 411.583 |
| Monoisotopic Mass | 411.29847 |
| SMILES | CCC/C=C\C/C=C\CCCCCC(O)CC(=O)O[C@@H](CCC(=O)[O-])[N+](C)(C)C |
| InChI | InChI=1S/C23H41NO5/c1-5-6-7-8-9-10-11-12-13-14-15-16-20(25)19-23(28)29-21(24(2,3)4)17-18-22(26)27/h7-8,10-11,20-21,25H,5-6,9,12-19H2,1-4H3/b8-7-,11-10-/t20?,21-/m0/s1 |
| InChIKey | CBBAYEUCTOLHMQ-WLXWJKFFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| Pooled sample (NCIT:C45910) | MetaboLights (MTBLS2128) | ||
| blood plasma (BTO:0000131) | MetaboLights (MTBLS2128) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-Hydroxyhexadecadienoylcarnitine (CHEBI:171691) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| IUPAC Name |
|---|
| (4S)-4-[(9Z,12Z)-3-hydroxyhexadeca-9,12-dienoyl]oxy-4-(trimethylazaniumyl)butanoate |
| Manual Xrefs | Databases |
|---|---|
| HMDB0013335 | HMDB |
| 35032594 | ChemSpider |