EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H19NO3 |
| Net Charge | 0 |
| Average Mass | 201.266 |
| Monoisotopic Mass | 201.13649 |
| SMILES | CCCC(CCC)C(=O)NCC(=O)O |
| InChI | InChI=1S/C10H19NO3/c1-3-5-8(6-4-2)10(14)11-7-9(12)13/h8H,3-7H2,1-2H3,(H,11,14)(H,12,13) |
| InChIKey | QBKXUUNBNHZZPK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| Pooled sample (NCIT:C45910) | MetaboLights (MTBLS2128) | ||
| blood plasma (BTO:0000131) | MetaboLights (MTBLS2128) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Valproylglycine (CHEBI:171680) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| 2-(2-propylpentanoylamino)acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 158232 | ChemSpider |
| HMDB0013116 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:88321-07-7 | ChemIDplus |