EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H34O5 |
| Net Charge | 0 |
| Average Mass | 342.476 |
| Monoisotopic Mass | 342.24062 |
| SMILES | CCCCCC(O)/C=C/C(=O)C(CCCCCCCC(=O)O)OC |
| InChI | InChI=1S/C19H34O5/c1-3-4-8-11-16(20)14-15-17(21)18(24-2)12-9-6-5-7-10-13-19(22)23/h14-16,18,20H,3-13H2,1-2H3,(H,22,23)/b15-14+ |
| InChIKey | VFSWPXFUIZSPGW-CCEZHUSRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| Pooled sample (NCIT:C45910) | MetaboLights (MTBLS2128) | ||
| blood plasma (BTO:0000131) | MetaboLights (MTBLS2128) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 13-Hydroxy-9-methoxy-10-oxo-11-octadecenoic acid (CHEBI:171679) is a hydroxy fatty acid (CHEBI:24654) |
| IUPAC Name |
|---|
| (E)-13-hydroxy-9-methoxy-10-oxooctadec-11-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4897173 | ChemSpider |
| HMDB0040901 | HMDB |
| LMFA02000288 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:150147-08-3 | ChemIDplus |