EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C44H54O17 |
| Net Charge | 0 |
| Average Mass | 854.899 |
| Monoisotopic Mass | 854.33610 |
| SMILES | CCC[C@@H](C)/C=C(/C)C(=O)O[C@@H]1[C@H](C)O[C@@H](O[C@H]2CC[C@H](O[C@@H]3C(O)=C(C(C)=O)C(=O)[C@@]4(O)C(=O)c5c(O)c6c(c(C)c5C[C@@]34O)C(=O)C(OC)=CC6=O)O[C@@H]2C)C[C@@]1(C)O |
| InChI | InChI=1S/C44H54O17/c1-10-11-18(2)14-19(3)41(52)61-39-23(7)58-29(17-42(39,8)53)59-26-12-13-28(57-22(26)6)60-40-36(49)31(21(5)45)37(50)44(55)38(51)32-24(16-43(40,44)54)20(4)30-33(35(32)48)25(46)15-27(56-9)34(30)47/h14-15,18,22-23,26,28-29,39-40,48-49,53-55H,10-13,16-17H2,1-9H3/b19-14-/t18-,22-,23+,26+,28+,29+,39-,40-,42-,43-,44-/m1/s1 |
| InChIKey | XLXKPBAXLAAHEN-WNMWLNICSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces minoensis (ncbitaxon:67329) | - | PubMed (27195476) | GenBank: KP710956.1 Strain: NRRL B-5482 |
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (1490891) | Strain: 1725 |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. autophagy inducer Any compound that induces the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dutomycin (CHEBI:171673) has role antineoplastic agent (CHEBI:35610) |
| dutomycin (CHEBI:171673) has role apoptosis inducer (CHEBI:68495) |
| dutomycin (CHEBI:171673) has role autophagy inducer (CHEBI:138880) |
| dutomycin (CHEBI:171673) has role bacterial metabolite (CHEBI:76969) |
| dutomycin (CHEBI:171673) is a 1,4-benzoquinones (CHEBI:132124) |
| dutomycin (CHEBI:171673) is a anthracycline antibiotic (CHEBI:49322) |
| dutomycin (CHEBI:171673) is a carbohydrate-containing antibiotic (CHEBI:23007) |
| dutomycin (CHEBI:171673) is a carbopolycyclic compound (CHEBI:35294) |
| dutomycin (CHEBI:171673) is a disaccharide derivative (CHEBI:63353) |
| dutomycin (CHEBI:171673) is a enoate ester (CHEBI:51702) |
| dutomycin (CHEBI:171673) is a enol (CHEBI:33823) |
| dutomycin (CHEBI:171673) is a ether (CHEBI:25698) |
| dutomycin (CHEBI:171673) is a phenols (CHEBI:33853) |
| dutomycin (CHEBI:171673) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| IUPAC Name |
|---|
| (2R,3S,6S)-6-{[(1R,4aS,12aR)-3-acetyl-2,4a,6,12a-tetrahydroxy-9-methoxy-11-methyl-4,5,7,10-tetraoxo-1,4,4a,5,7,10,12,12a-octahydrotetracen-1-yl]oxy}-2-methyltetrahydro-2H-pyran-3-yl 2,6-dideoxy-4-O-[(2Z,4R)-2,4-dimethylhept-2-enoyl]-3-C-methyl-α-L-xylo-hexopyranoside |
| Registry Numbers | Sources |
|---|---|
| CAS:146663-67-4 | ChemIDplus |
| Citations |
|---|