EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O3 |
| Net Charge | 0 |
| Average Mass | 248.322 |
| Monoisotopic Mass | 248.14124 |
| SMILES | [H][C@@]12C[C@H](C)CCC(=O)/C(C)=C/C[C@]1([H])C(=C)C(=O)O2 |
| InChI | InChI=1S/C15H20O3/c1-9-4-7-13(16)10(2)5-6-12-11(3)15(17)18-14(12)8-9/h5,9,12,14H,3-4,6-8H2,1-2H3/b10-5+/t9-,12-,14-/m1/s1 |
| InChIKey | YDOSHXAMLRSCKS-IPANDGBHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Inula viscosa (ncbitaxon:56525) | |||
| - | PubMed (33296597) | Plant also known as Dittrichia viscosa. | |
| aerial part (BTO:0001658) | DOI (10.1016/j.phytochem.2012.10.003) |
| Roles Classification |
|---|
| Biological Roles: | phytotoxin Any toxin produced by a plant. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antiamoebic agent An antiparasitic agent which is effective against amoeba, a genus of single-celled amoeboids in the family Amoebidae. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| inuloxin A (CHEBI:171660) has role antiamoebic agent (CHEBI:171664) |
| inuloxin A (CHEBI:171660) has role antifungal agent (CHEBI:35718) |
| inuloxin A (CHEBI:171660) has role herbicide (CHEBI:24527) |
| inuloxin A (CHEBI:171660) has role phytotoxin (CHEBI:38231) |
| inuloxin A (CHEBI:171660) is a cyclic ketone (CHEBI:3992) |
| inuloxin A (CHEBI:171660) is a organic heterobicyclic compound (CHEBI:27171) |
| inuloxin A (CHEBI:171660) is a sesquiterpene lactone (CHEBI:37667) |
| IUPAC Name |
|---|
| (3aR,5E,10R,11aR)-6,10-dimethyl-3-methylidene-3a,8,9,10,11,11a-hexahydrocyclodeca[b]furan-2,7(3H,4H)-dione |
| Citations |
|---|