EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O3 |
| Net Charge | 0 |
| Average Mass | 280.323 |
| Monoisotopic Mass | 280.10994 |
| SMILES | [H]C(/C=C/C#CC#CC#CC#C)=C([H])C(O)CCCCC(=O)O |
| InChI | InChI=1S/C18H16O3/c1-2-3-4-5-6-7-8-9-10-11-14-17(19)15-12-13-16-18(20)21/h1,9-11,14,17,19H,12-13,15-16H2,(H,20,21)/b10-9+,14-11? |
| InChIKey | GOOGOKNSXZDSND-XUZRCACFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trinickia caryophylli (ncbitaxon:28094) | - | DOI (10.1016/S0040-4039(00)96437-2) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| caryoynencin (CHEBI:171657) has role antibacterial agent (CHEBI:33282) |
| caryoynencin (CHEBI:171657) has role bacterial metabolite (CHEBI:76969) |
| caryoynencin (CHEBI:171657) is a acetylenic fatty acid (CHEBI:25380) |
| caryoynencin (CHEBI:171657) is a long-chain fatty acid (CHEBI:15904) |
| caryoynencin (CHEBI:171657) is a polyunsaturated fatty acid (CHEBI:26208) |
| caryoynencin (CHEBI:171657) is a secondary alcohol (CHEBI:35681) |
| caryoynencin (CHEBI:171657) is a terminal acetylenic compound (CHEBI:73477) |
| Citations |
|---|