EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O3 |
| Net Charge | 0 |
| Average Mass | 186.251 |
| Monoisotopic Mass | 186.12559 |
| SMILES | [H]C(=O)CCCCCCCCC(=O)O |
| InChI | InChI=1S/C10H18O3/c11-9-7-5-3-1-2-4-6-8-10(12)13/h9H,1-8H2,(H,12,13) |
| InChIKey | FYURGFQVSMALOD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 10-oxocapric acid (CHEBI:17130) has functional parent decanoic acid (CHEBI:30813) |
| 10-oxocapric acid (CHEBI:17130) is a aldehydic acid (CHEBI:26643) |
| 10-oxocapric acid (CHEBI:17130) is a medium-chain fatty acid (CHEBI:59554) |
| 10-oxocapric acid (CHEBI:17130) is a oxo monocarboxylic acid (CHEBI:35871) |
| 10-oxocapric acid (CHEBI:17130) is a ω-oxo fatty acid (CHEBI:76328) |
| 10-oxocapric acid (CHEBI:17130) is conjugate acid of 10-oxocaprate (CHEBI:58022) |
| Incoming Relation(s) |
| 10-oxocaprate (CHEBI:58022) is conjugate base of 10-oxocapric acid (CHEBI:17130) |
| IUPAC Name |
|---|
| 10-oxodecanoic acid |
| Synonyms | Source |
|---|---|
| 9-aldehydononanoic acid | ChEBI |
| 9-formylnonanoic acid | ChemIDplus |
| 9-formylpelargonic acid | ChEBI |
| sebacaldehydic acid | ChEBI |
| sebacic semialdehyde | ChEBI |
| ω-oxocapric acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C02217 | KEGG COMPOUND |
| LMFA01060078 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1766800 | Beilstein |
| CAS:5578-80-3 | ChemIDplus |